CAS 75220-84-7 appears in our catalog under these names: Anticonvulsant agent 2/ 96.38% (existing batch purity), Anticonvulsant agent 2, Anticonvulsant agent 2, Anticonvulsant agent 2, 98.00%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 200mg.
4-(4-chlorophenyl)-2-phenyl-2,3-dihydro-1H-1,5-benzodiazepine (CAS 75220-84-7) is a chemical compound with the molecular formula C21H17ClN2 and a molecular weight of 332.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-phenyl-2,3-dihydro-1H-1,5-benzodiazepine. InChIKey: HGXLBVMEBUESSS-UHFFFAOYSA-N.
| Molecular formula | C21H17ClN2 |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-phenyl-2,3-dihydro-1H-1,5-benzodiazepine |
| InChIKey | HGXLBVMEBUESSS-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2N=C1C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)