Asapiprant, 98%
cas: 932372-01-5 — see every product listed under this CAS number, including other names
Asapiprant, 98% (CAS 932372-01-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A724929-100mg |
| cas | 932372-01-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2016.88 Pln | |
| Chemat | 1mg | 213.20 Pln | |
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 10mg | 376.40 Pln | |
| Chemat | 25mg | 688.40 Pln | |
| Fluorochem | 1mg | 367.60 Pln | |
| Fluorochem | 5mg | 424.87 Pln | |
| Fluorochem | 10mg | 679.99 Pln | |
| Fluorochem | 25mg | 1273.53 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid (CAS 932372-01-5) is a chemical compound with the molecular formula C24H27N3O7S and a molecular weight of 501.6 g/mol. IUPAC name: 2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid. InChIKey: ZMZNWNTZRWXTJU-UHFFFAOYSA-N.
| Molecular formula | C24H27N3O7S |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid |
| InChIKey | ZMZNWNTZRWXTJU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C3=CC(=C(C=C3)C4=NC=CO4)OCC(=O)O |
Computed by PubChem (NCBI)