CAS 932372-01-5 appears in our catalog under these names: Asapiprant (S–555739), Asapiprant/ 99.23% (existing batch purity), Asapiprant, Asapiprant 98%, ASapiprant, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid (CAS 932372-01-5) is a chemical compound with the molecular formula C24H27N3O7S and a molecular weight of 501.6 g/mol. IUPAC name: 2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid. InChIKey: ZMZNWNTZRWXTJU-UHFFFAOYSA-N.
| Molecular formula | C24H27N3O7S |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 2-[2-(1,3-oxazol-2-yl)-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetic acid |
| InChIKey | ZMZNWNTZRWXTJU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C3=CC(=C(C=C3)C4=NC=CO4)OCC(=O)O |
Computed by PubChem (NCBI)