Products 1262888-20-9
CAS 1262888-20-9 appears in our catalog under these names: Autophagy-IN-A9/ 100%, Autophagy-IN-5, 98.29%, Autophagy-IN-A9. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 10 mg.
N-[(4-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine (CAS 1262888-20-9) is a chemical compound with the molecular formula C15H11ClFN3 and a molecular weight of 287.72 g/mol. IUPAC name: N-[(4-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine. InChIKey: UKKFWKDNHGAJTR-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFN3 |
|---|---|
| Molecular weight | 287.72 g/mol |
| IUPAC name | N-[(4-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine |
| InChIKey | UKKFWKDNHGAJTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=NC=NC3=C2C=C(C=C3)F)Cl |
Computed by PubChem (NCBI)