cas: 4531-54-8 — see every product listed under this CAS number, including other names
Azathioprine Related Compound A 95% (CAS 4531-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A702114-100mg |
| cas | 4531-54-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1621.94 Pln | |
| Ambeed | 10g | 2784.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A702114 |
3-methyl-5-nitroimidazol-4-amine (CAS 4531-54-8) is a chemical compound with the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. IUPAC name: 3-methyl-5-nitroimidazol-4-amine. InChIKey: GJVMTMXQJDQJSS-UHFFFAOYSA-N.
| Molecular formula | C4H6N4O2 |
|---|---|
| Molecular weight | 142.12 g/mol |
| IUPAC name | 3-methyl-5-nitroimidazol-4-amine |
| InChIKey | GJVMTMXQJDQJSS-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)