Azido-PEG5-acid 98%
cas: 1425973-16-5 — see every product listed under this CAS number, including other names
Azido-PEG5-acid 98% (CAS 1425973-16-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754709-5g |
| cas | 1425973-16-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 4236.31 Pln | |
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1260.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754709 |
3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1425973-16-5) is a chemical compound with the molecular formula C13H25N3O7 and a molecular weight of 335.35 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DPJUPQILWDVIKK-UHFFFAOYSA-N.
| Molecular formula | C13H25N3O7 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DPJUPQILWDVIKK-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)