Azido-PEG5-acid, 97%
cas: 1425973-16-5 — see every product listed under this CAS number, including other names
Azido-PEG5-acid, 97% (CAS 1425973-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988640-100MG |
| cas | 1425973-16-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 4975.35 Pln | |
| Fluorochem | 10g | 9421.70 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1425973-16-5) is a chemical compound with the molecular formula C13H25N3O7 and a molecular weight of 335.35 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DPJUPQILWDVIKK-UHFFFAOYSA-N.
| Molecular formula | C13H25N3O7 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DPJUPQILWDVIKK-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)