Azido-PEG5-acid, 98.0%
cas: 1425973-16-5 — see every product listed under this CAS number, including other names
Azido-PEG5-acid, 98.0% (CAS 1425973-16-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 100 mg, 10 g, 250 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130572-5 g |
| cas | 1425973-16-5 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 5158.74 Pln | |
| MedChemExpress | 500 mg | 951.28 Pln | |
| MedChemExpress | 100 mg | 551.89 Pln | |
| MedChemExpress | 10 g | 9189.73 Pln | |
| MedChemExpress | 250 mg | 667.99 Pln | |
| MedChemExpress | 1 g | 1411.03 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1425973-16-5) is a chemical compound with the molecular formula C13H25N3O7 and a molecular weight of 335.35 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DPJUPQILWDVIKK-UHFFFAOYSA-N.
| Molecular formula | C13H25N3O7 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DPJUPQILWDVIKK-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)