cas: 1135871-85-0 — see every product listed under this CAS number, including other names
B-(5,6,7,8-Tetrahydro-8-oxo-2-naphthalenyl)boronic acid, 97%, 97% (CAS 1135871-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCQH-100mg |
| cas | 1135871-85-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 4610.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid (CAS 1135871-85-0) is a chemical compound with the molecular formula C10H11BO3 and a molecular weight of 190.01 g/mol. IUPAC name: (8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid. InChIKey: SXFJBJJYSFLTMC-UHFFFAOYSA-N.
| Molecular formula | C10H11BO3 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid |
| InChIKey | SXFJBJJYSFLTMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCCC2=O)C=C1)(O)O |
Computed by PubChem (NCBI)