Products 1093108-50-9
CAS 1093108-50-9 appears in our catalog under these names: BI-671800/ 98.06% (existing batch purity), BI–671800, BI-671800, BI-671800, ≥98%, ≥98%, BI-671800, 99.36%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetic acid (CAS 1093108-50-9) is a chemical compound with the molecular formula C25H26F3N5O3 and a molecular weight of 501.5 g/mol. IUPAC name: 2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetic acid. InChIKey: XEOSTBFUCNZKGS-UHFFFAOYSA-N.
| Molecular formula | C25H26F3N5O3 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | 2-[4,6-bis(dimethylamino)-2-[[4-[[4-(trifluoromethyl)benzoyl]amino]phenyl]methyl]pyrimidin-5-yl]acetic acid |
| InChIKey | XEOSTBFUCNZKGS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=NC(=N1)CC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)C(F)(F)F)N(C)C)CC(=O)O |
Computed by PubChem (NCBI)