Products 2040401-92-9
CAS 2040401-92-9 appears in our catalog under these names: BI–6901, BI-6901/ 99.83% (existing batch purity), BI-6901, BI-6901, 99.94%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 10 mg, 5 mg.
N-[(2R)-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-1H-indole-4-sulfonamide (CAS 2040401-92-9) is a chemical compound with the molecular formula C23H27N5O3S and a molecular weight of 453.6 g/mol. IUPAC name: N-[(2R)-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-1H-indole-4-sulfonamide. InChIKey: BRJXJOWXAFLRTE-OAQYLSRUSA-N.
| Molecular formula | C23H27N5O3S |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | N-[(2R)-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-1H-indole-4-sulfonamide |
| InChIKey | BRJXJOWXAFLRTE-OAQYLSRUSA-N |
| SMILES | CC1CCN(CC1)C(=O)[C@@H](CCN2C=CC=C2C#N)NS(=O)(=O)C3=CC=CC4=C3C=CN4 |
Computed by PubChem (NCBI)
Synonyms:
eut-22, orb1693698