Products 156635-05-1
CAS 156635-05-1 appears in our catalog under these names: BIBB 515/ 97.78% (existing batch purity), BIBB 515, BIBB 515, 99.56%, BIBB 515. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 50mg, 10 mg, 1 mg, 5 mg.
(4-chlorophenyl)-[4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methylidene]piperidin-1-yl]methanone (CAS 156635-05-1) is a chemical compound with the molecular formula C22H21ClN2O2 and a molecular weight of 380.9 g/mol. IUPAC name: (4-chlorophenyl)-[4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methylidene]piperidin-1-yl]methanone. InChIKey: JQNWPWUJMRAASQ-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN2O2 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | (4-chlorophenyl)-[4-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methylidene]piperidin-1-yl]methanone |
| InChIKey | JQNWPWUJMRAASQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=CC2=CC=C(C=C2)C3=NCCO3)C(=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)