cas: 84783-64-2 — see every product listed under this CAS number, including other names
BIPHEP 98% (CAS 84783-64-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A920440-100mg |
| cas | 84783-64-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 1816.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A920440 |
[2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane (CAS 84783-64-2) is a chemical compound with the molecular formula C36H28P2 and a molecular weight of 522.6 g/mol. IUPAC name: [2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane. InChIKey: GRTJBNJOHNTQBO-UHFFFAOYSA-N.
| Molecular formula | C36H28P2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | [2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane |
| InChIKey | GRTJBNJOHNTQBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)