CAS 18200-13-0 appears in our catalog under these names: BL-1249/ 98.25% (existing batch purity), BL 1249, BL 1249, BL-1249, BL-1249, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
N-[2-(2H-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine (CAS 18200-13-0) is a chemical compound with the molecular formula C17H17N5 and a molecular weight of 291.35 g/mol. IUPAC name: N-[2-(2H-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine. InChIKey: YYNRZIFBTOUICE-UHFFFAOYSA-N.
| Molecular formula | C17H17N5 |
|---|---|
| Molecular weight | 291.35 g/mol |
| IUPAC name | N-[2-(2H-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine |
| InChIKey | YYNRZIFBTOUICE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC=C2NC3=CC=CC=C3C4=NNN=N4 |
Computed by PubChem (NCBI)