Products 2854-32-2
CAS 2854-32-2 appears in our catalog under these names: Ethanone, 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)-, 99%, BML–190, BML-190/ 99.51% (existing batch purity), BML-190, BML-190 99%. Offered by: Fluorochem, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 10mM (in 1ml dmso), 500mg, 200mg.
2-[2-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-1-morpholin-4-ylethanone (CAS 2854-32-2) is a chemical compound with the molecular formula C23H23ClN2O4 and a molecular weight of 426.9 g/mol. IUPAC name: 2-[2-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-1-morpholin-4-ylethanone. InChIKey: OOKFHWWAUUITQR-UHFFFAOYSA-N.
| Molecular formula | C23H23ClN2O4 |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | 2-[2-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-1-morpholin-4-ylethanone |
| InChIKey | OOKFHWWAUUITQR-UHFFFAOYSA-N |
| SMILES | CC1(C(=C2C=C(C=CC2=N1)OC)CC(=O)N3CCOCC3)C(=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)