cas: 269726-80-9 — see every product listed under this CAS number, including other names
BOC-(R)-3-AMINO-4-(2-CYANO-PHENYL)-BUTYRIC ACID, 98%, 98% (CAS 269726-80-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCVI-25mg |
| cas | 269726-80-9 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 309.20 Pln | |
| Chemat | 100mg | 717.20 Pln | |
| Chemat | 250mg | 1230.80 Pln | |
| Chemat | 1g | 3347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269726-80-9) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: (3R)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: HBMUTHPYXNFHBB-CYBMUJFWSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (3R)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | HBMUTHPYXNFHBB-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1C#N)CC(=O)O |
Computed by PubChem (NCBI)