CAS 270065-83-3 appears in our catalog under these names: Boc-(s)-3-amino-4-(2-cyano-phenyl)-butyric acid, 95%, (S)-3-((tert-Butoxycarbonyl)amino)-4-(2-cyanophenyl)butanoic acid, 95+%, (S)–3–((tert–Butoxycarbonyl)amino)–4–(2–cyanophenyl)butanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(3S)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270065-83-3) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: (3S)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: HBMUTHPYXNFHBB-ZDUSSCGKSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (3S)-4-(2-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | HBMUTHPYXNFHBB-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1C#N)CC(=O)O |
Computed by PubChem (NCBI)