CAS 1204572-55-3 appears in our catalog under these names: BPAM344, BPAM344/ 99.57% (existing batch purity), BPAM-344, BPAM344 98%, 4-Cyclopropyl-7-fluoro-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 2mg, 200mg, 250mg.
4-cyclopropyl-7-fluoro-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 1204572-55-3) is a chemical compound with the molecular formula C10H11FN2O2S and a molecular weight of 242.27 g/mol. IUPAC name: 4-cyclopropyl-7-fluoro-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: FLTMTBPCYAZIKM-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O2S |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-cyclopropyl-7-fluoro-2,3-dihydro-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | FLTMTBPCYAZIKM-UHFFFAOYSA-N |
| SMILES | C1CC1N2CNS(=O)(=O)C3=C2C=CC(=C3)F |
Computed by PubChem (NCBI)