Benzene, 1,3-dibromo-2,5-dichloro-, 98%, 98%
cas: 81067-41-6 — see every product listed under this CAS number, including other names
Benzene, 1,3-dibromo-2,5-dichloro-, 98%, 98% (CAS 81067-41-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119LBE-1g |
| cas | 81067-41-6 |
| size | 1g |
| availability | 1095g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 100g | 462.80 Pln | |
| Chemat | 500g | 1166.40 Pln | |
| Chemat | 1kg | 2114.00 Pln | |
| Chemat | 50g | 290.00 Pln | |
| Chemat | 250g | 750.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-2,5-dichlorobenzene (CAS 81067-41-6) is a chemical compound with the molecular formula C6H2Br2Cl2 and a molecular weight of 304.79 g/mol. IUPAC name: 1,3-dibromo-2,5-dichlorobenzene. InChIKey: HKKSDHKJUSSWAI-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2Cl2 |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 1,3-dibromo-2,5-dichlorobenzene |
| InChIKey | HKKSDHKJUSSWAI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)Cl |
Computed by PubChem (NCBI)