CAS 81067-41-6 appears in our catalog under these names: 1,3–Dibromo–2,5–dichlorobenzene, 1,3-Dibromo-2,5-dichlorobenzene 98%, Benzene, 1,3-dibromo-2,5-dichloro-, 98%, 98%, 1,3-Dibromo-2,5-dichlorobenzene, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 500g, 1g, 10g, 25g, 100g, 1kg, 50g.
1,3-dibromo-2,5-dichlorobenzene (CAS 81067-41-6) is a chemical compound with the molecular formula C6H2Br2Cl2 and a molecular weight of 304.79 g/mol. IUPAC name: 1,3-dibromo-2,5-dichlorobenzene. InChIKey: HKKSDHKJUSSWAI-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2Cl2 |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 1,3-dibromo-2,5-dichlorobenzene |
| InChIKey | HKKSDHKJUSSWAI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)Cl |
Computed by PubChem (NCBI)