CAS 100191-21-7 appears in our catalog under these names: 1,3-Dibromo-4,6-dichlorobenzene, 95%, 1,5-Dibromo-2,4-dichlorobenzene, 95+%, 1,5-dibromo-2,4-dichlorobenzene, 98%, 98%, 1,5-Dibromo-2,4-dichlorobenzene. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1,5-dibromo-2,4-dichlorobenzene (CAS 100191-21-7) is a chemical compound with the molecular formula C6H2Br2Cl2 and a molecular weight of 304.79 g/mol. IUPAC name: 1,5-dibromo-2,4-dichlorobenzene. InChIKey: AIYBGLGSFXUJDS-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2Cl2 |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 1,5-dibromo-2,4-dichlorobenzene |
| InChIKey | AIYBGLGSFXUJDS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Br)Cl |
Computed by PubChem (NCBI)