cas: 103966-66-1 — see every product listed under this CAS number, including other names
Benzene, 4-bromo-2-methoxy-1-nitro-, 98%, 98% (CAS 103966-66-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 50g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MHU-1g |
| cas | 103966-66-1 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 1029.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 50g | 544.40 Pln | |
| Chemat | 500g | 4166.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-methoxy-1-nitrobenzene (CAS 103966-66-1) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 4-bromo-2-methoxy-1-nitrobenzene. InChIKey: DJKPQYBFSAJUBS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-bromo-2-methoxy-1-nitrobenzene |
| InChIKey | DJKPQYBFSAJUBS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)