cas: 401916-48-1 — see every product listed under this CAS number, including other names
Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-4-(1,1-dimethylethyl)-, (βR)-, 98%, 98% (CAS 401916-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXJ8-100mg |
| cas | 401916-48-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 472.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 401916-48-1) is a chemical compound with the molecular formula C19H29NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (3R)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VJXYUVJDZAIFHC-OAHLLOKOSA-N.
| Molecular formula | C19H29NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (3R)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VJXYUVJDZAIFHC-OAHLLOKOSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)