cas: 19377-04-9 — see every product listed under this CAS number, including other names
Benzenesulfonamide, N-(3-chlorophenyl)-4-methyl-, 98%, 98% (CAS 19377-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AMO6-1g |
| cas | 19377-04-9 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1557.20 Pln | |
| Chemat | 5g | 5987.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(3-chlorophenyl)-4-methylbenzenesulfonamide (CAS 19377-04-9) is a chemical compound with the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. IUPAC name: N-(3-chlorophenyl)-4-methylbenzenesulfonamide. InChIKey: SWWNOFCZFSEIDE-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | N-(3-chlorophenyl)-4-methylbenzenesulfonamide |
| InChIKey | SWWNOFCZFSEIDE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)