CAS 1082842-30-5 is the registry number for 4-[(3-Chlorophenyl)methanesulfonyl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(3-chlorophenyl)methylsulfonyl]aniline (CAS 1082842-30-5) is a chemical compound with the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. IUPAC name: 4-[(3-chlorophenyl)methylsulfonyl]aniline. InChIKey: ZRRRLLCIUOJUAG-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methylsulfonyl]aniline |
| InChIKey | ZRRRLLCIUOJUAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)