CAS 16937-20-5 appears in our catalog under these names: N-Benzyl-3-chloro-benzenesulfonamide, 95%, N-Benzyl-3-chlorobenzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
N-benzyl-3-chlorobenzenesulfonamide (CAS 16937-20-5) is a chemical compound with the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. IUPAC name: N-benzyl-3-chlorobenzenesulfonamide. InChIKey: BQZRGQCTSXEEFW-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | N-benzyl-3-chlorobenzenesulfonamide |
| InChIKey | BQZRGQCTSXEEFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)