Benzo[b]naphtho[1,2-d]thiophene, 97%
cas: 205-43-6 — see every product listed under this CAS number, including other names
Benzo[b]naphtho[1,2-d]thiophene, 97% (CAS 205-43-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A138645-250mg |
| cas | 205-43-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 426.00 Pln | |
| Ambeed | 100g | 1477.31 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 169.96 Pln | |
| BLDpharm | 10g | 225.50 Pln | |
| BLDpharm | 25g | 453.20 Pln | |
| BLDpharm | 100g | 1297.35 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Naphtho[2,1-b][1]benzothiole (CAS 205-43-6) is a chemical compound with the molecular formula C16H10S and a molecular weight of 234.3 g/mol. IUPAC name: naphtho[2,1-b][1]benzothiole. InChIKey: XZUMOEVHCZXMTR-UHFFFAOYSA-N.
| Molecular formula | C16H10S |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | naphtho[2,1-b][1]benzothiole |
| InChIKey | XZUMOEVHCZXMTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4S3 |
Computed by PubChem (NCBI)
Synonyms:
Benzo[b]naphtho[1,2-d]thiophene, Benzo(b)naphtho(1,2-d)thiophene, naphtho[2,1-b][1]benzothiole, 3,4-Benzo-9-thiafluorene, Naphtho(2,1-b)thianaphthene, Naphtho[2,1-b]thianaphthene, BENZO (b) NAPHTHO (1,2-d) THIOPHENE (purity), 7-Thia-7H-benzo[c]fluorene, 5-17-02-00434 (Beilstein Handbook Reference), naphtho[2,1-b]benzothiophene