Products 3245-11-2
CAS 3245-11-2 is the registry number for Pyrene-1-Thiol, 96%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg, 250mg.
Pyrene-1-thiol (CAS 3245-11-2) is a chemical compound with the molecular formula C16H10S and a molecular weight of 234.3 g/mol. IUPAC name: pyrene-1-thiol. InChIKey: ZLJXXSDJRKUBQX-UHFFFAOYSA-N.
| Molecular formula | C16H10S |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | pyrene-1-thiol |
| InChIKey | ZLJXXSDJRKUBQX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)S |
Computed by PubChem (NCBI)