cas: 112809-25-3 — see every product listed under this CAS number, including other names
Benzonitrile,4-(1H-1,2,4-triazol-1-ylmethyl)-, 90%, 90% (CAS 112809-25-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118S8C-250mg |
| cas | 112809-25-3 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 1950.80 Pln | |
| Chemat | 100g | 5498.00 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 500g | 21873.60 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
4-(1,2,4-triazol-1-ylmethyl)benzonitrile (CAS 112809-25-3) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 4-(1,2,4-triazol-1-ylmethyl)benzonitrile. InChIKey: HQLYWHSJALKYOV-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-ylmethyl)benzonitrile |
| InChIKey | HQLYWHSJALKYOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)C#N |
Computed by PubChem (NCBI)