Products 1203499-48-2
CAS 1203499-48-2 is the registry number for 2-Amino-6-methyl-1,8-naphthyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-amino-6-methyl-1,8-naphthyridine-3-carbonitrile (CAS 1203499-48-2) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 2-amino-6-methyl-1,8-naphthyridine-3-carbonitrile. InChIKey: AWOYWYUGJKKFNO-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 2-amino-6-methyl-1,8-naphthyridine-3-carbonitrile |
| InChIKey | AWOYWYUGJKKFNO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2N=C1)N)C#N |
Computed by PubChem (NCBI)