CAS 131052-51-2 appears in our catalog under these names: 8-(Azidomethyl)quinoline, 95%, 8-(Azidomethyl)quinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,25g, 0,1g, 0,5g.
8-(azidomethyl)quinoline (CAS 131052-51-2) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 8-(azidomethyl)quinoline. InChIKey: CSNBVUNMDWVXCJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 8-(azidomethyl)quinoline |
| InChIKey | CSNBVUNMDWVXCJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CN=[N+]=[N-])N=CC=C2 |
Computed by PubChem (NCBI)