cas: 62471-40-3 — see every product listed under this CAS number, including other names
Benzyl (1-hydroxy-2-methylpropan-2-yl)carbamate 95% (CAS 62471-40-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215739-250mg |
| cas | 62471-40-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 915.50 Pln | |
| Ambeed | 1g | 2194.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A215739 |
Benzyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate (CAS 62471-40-3) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: benzyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate. InChIKey: CXMLBZXMMMIGES-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | benzyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate |
| InChIKey | CXMLBZXMMMIGES-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)