CAS 660870-16-6 is the registry number for 5-Amino-2-methoxyphenyl pivalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(5-amino-2-methoxyphenyl) 2,2-dimethylpropanoate (CAS 660870-16-6) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: (5-amino-2-methoxyphenyl) 2,2-dimethylpropanoate. InChIKey: WLYDBFKMNWUZDX-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (5-amino-2-methoxyphenyl) 2,2-dimethylpropanoate |
| InChIKey | WLYDBFKMNWUZDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=C(C=CC(=C1)N)OC |
Computed by PubChem (NCBI)