Products 254751-16-1
CAS 254751-16-1 is the registry number for 2-((3S,5S,7S)-Adamantan-1-ylamino)-2-oxoacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
2-(1-adamantylamino)-2-oxoacetic acid (CAS 254751-16-1) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: 2-(1-adamantylamino)-2-oxoacetic acid. InChIKey: RNFGKUDJEFWDAG-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(1-adamantylamino)-2-oxoacetic acid |
| InChIKey | RNFGKUDJEFWDAG-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)C(=O)O |
Computed by PubChem (NCBI)