Benzyl (4-nitrophenyl) carbonate, 97%
cas: 13795-24-9 — see every product listed under this CAS number, including other names
Benzyl (4-nitrophenyl) carbonate, 97% (CAS 13795-24-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1128Q4-1g |
| cas | 13795-24-9 |
| size | 1g |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 100g | 1562.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 286.59 Pln | |
| BLDpharm | 25g | 919.70 Pln | |
| BLDpharm | 100g | 3063.39 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 25g | 763.29 Pln | |
| Fluorochem | 100g | 2793.83 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (4-nitrophenyl) carbonate (CAS 13795-24-9) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: benzyl (4-nitrophenyl) carbonate. InChIKey: QIXRWIVDBZJDGD-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | benzyl (4-nitrophenyl) carbonate |
| InChIKey | QIXRWIVDBZJDGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Benzyl 4-nitrophenyl carbonate, benzyl (4-nitrophenyl) carbonate, Carbonic acid, 4-nitrophenyl phenylmethyl ester, p-Nitrophenyl benzyl carbonate, 4-Nitrophenyl benzyl carbonate, Carbonic acid, benzyl p-nitrophenyl ester, Benzyl p-nitrophenyl carbonate, Carbonic Acid Benzyl 4-Nitrophenyl Ester, Benzyl (p-nitrophenyl) carbonate, QIXRWIVDBZJDGD-UHFFFAOYSA-