cas: 1250999-44-0 — see every product listed under this CAS number, including other names
Benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate, 97%, 97% (CAS 1250999-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AA9U-100mg |
| cas | 1250999-44-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1091.60 Pln | |
| Chemat | 1g | 2570.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 1250999-44-0) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: ZJGKPSLOUBRHLY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | ZJGKPSLOUBRHLY-UHFFFAOYSA-N |
| SMILES | C1CNC12CCN(CC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)