cas: 1250999-44-0 — see every product listed under this CAS number, including other names
Benzyl 3,7-diazaspiro[3.5]nonane-7-carboxylate, 97% (CAS 1250999-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300623-100MG |
| cas | 1250999-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1237.08 Pln | |
| Fluorochem | 250mg | 2038.88 Pln | |
| Fluorochem | 1g | 4032.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 1250999-44-0) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: ZJGKPSLOUBRHLY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | benzyl 1,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | ZJGKPSLOUBRHLY-UHFFFAOYSA-N |
| SMILES | C1CNC12CCN(CC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)