Products 917925-59-8
CAS 917925-59-8 appears in our catalog under these names: tert-Butyl 4-amino-4-(4-chlorophenyl)piperidine-1-carboxylate, 95%, tert-Butyl 4-amino-4-(4-chlorophenyl)piperidine-1-carboxylate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl 4-amino-4-(4-chlorophenyl)piperidine-1-carboxylate (CAS 917925-59-8) is a chemical compound with the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. IUPAC name: tert-butyl 4-amino-4-(4-chlorophenyl)piperidine-1-carboxylate. InChIKey: RFZDLGITJYKDKY-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O2 |
|---|---|
| Molecular weight | 310.82 g/mol |
| IUPAC name | tert-butyl 4-amino-4-(4-chlorophenyl)piperidine-1-carboxylate |
| InChIKey | RFZDLGITJYKDKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)