Products 928034-35-9

CAS 928034-35-9 is the registry number for Benzyl 1,8-diazaspiro[4.5]decane-8-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 1,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride (CAS 928034-35-9) is a chemical compound with the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. IUPAC name: benzyl 1,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride. InChIKey: MXEVIUDORUFDMA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23ClN2O2
Molecular weight310.82 g/mol
IUPAC namebenzyl 1,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride
InChIKeyMXEVIUDORUFDMA-UHFFFAOYSA-N
SMILESC1CC2(CCN(CC2)C(=O)OCC3=CC=CC=C3)NC1.Cl

Computed by PubChem (NCBI)