cas: 1227381-91-0 — see every product listed under this CAS number, including other names
Benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride 95% (CAS 1227381-91-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A324434-250mg |
| cas | 1227381-91-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1449.50 Pln | |
| Ambeed | 5g | 3518.75 Pln | |
| Ambeed | 10g | 5232.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A324434 |
Benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 1227381-91-0) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: DITCBNHNFWNNFY-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride |
| InChIKey | DITCBNHNFWNNFY-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CN(C2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)