cas: 1227381-91-0 — see every product listed under this CAS number, including other names
benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, 95%, 95% (CAS 1227381-91-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111J9C-250mg |
| cas | 1227381-91-0 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 500mg | 798.80 Pln | |
| Chemat | 1g | 1197.20 Pln | |
| Chemat | 5g | 2896.40 Pln | |
| Chemat | 10g | 4317.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 1227381-91-0) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: DITCBNHNFWNNFY-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | benzyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride |
| InChIKey | DITCBNHNFWNNFY-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CN(C2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)