Products 1070716-32-3
CAS 1070716-32-3 is the registry number for tert-Butyl 4-(4-chlorophenyl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 10g.
Tert-butyl 4-(4-chlorophenyl)piperazine-1-carboxylate (CAS 1070716-32-3) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl 4-(4-chlorophenyl)piperazine-1-carboxylate. InChIKey: KWGJPILHSLHTNW-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O2 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl 4-(4-chlorophenyl)piperazine-1-carboxylate |
| InChIKey | KWGJPILHSLHTNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)