cas: 940868-17-7 — see every product listed under this CAS number, including other names
Benzyl 2-carbamoylpiperidine-1-carboxylate, 95%, 95% (CAS 940868-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRVZ-250mg |
| cas | 940868-17-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2-carbamoylpiperidine-1-carboxylate (CAS 940868-17-7) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: benzyl 2-carbamoylpiperidine-1-carboxylate. InChIKey: AJMWIWWTWGDVSH-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | benzyl 2-carbamoylpiperidine-1-carboxylate |
| InChIKey | AJMWIWWTWGDVSH-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)