CAS 1314806-92-2 is the registry number for Benzyl N-[(1S)-1-(cyclopropylcarbamoyl)ethyl]carbamate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Benzyl N-[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamate (CAS 1314806-92-2) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: benzyl N-[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamate. InChIKey: HITJKRMPYWLVJM-JTQLQIEISA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamate |
| InChIKey | HITJKRMPYWLVJM-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)NC1CC1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)