CAS 685565-18-8 is the registry number for tert-Butyl 5-carbamoylisoindoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 5-carbamoyl-1,3-dihydroisoindole-2-carboxylate (CAS 685565-18-8) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: tert-butyl 5-carbamoyl-1,3-dihydroisoindole-2-carboxylate. InChIKey: ALHOWQRUWZFEFO-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | tert-butyl 5-carbamoyl-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | ALHOWQRUWZFEFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)