cas: 105706-76-1 — see every product listed under this CAS number, including other names
Benzyl 2-formylpiperidine-1-carboxylate 98% (CAS 105706-76-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A390495-100mg |
| cas | 105706-76-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 2617.62 Pln | |
| Ambeed | 10g | 4503.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A390495 |
Benzyl 2-formylpiperidine-1-carboxylate (CAS 105706-76-1) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl 2-formylpiperidine-1-carboxylate. InChIKey: DIFLGEVEAZQPMO-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl 2-formylpiperidine-1-carboxylate |
| InChIKey | DIFLGEVEAZQPMO-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)