cas: 105706-76-1 — see every product listed under this CAS number, including other names
N-Cbz-Piperidine-2-carbaldehyde, 97% (CAS 105706-76-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049051-100MG |
| cas | 105706-76-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 500mg | 591.48 Pln | |
| Fluorochem | 1g | 830.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 2-formylpiperidine-1-carboxylate (CAS 105706-76-1) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl 2-formylpiperidine-1-carboxylate. InChIKey: DIFLGEVEAZQPMO-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl 2-formylpiperidine-1-carboxylate |
| InChIKey | DIFLGEVEAZQPMO-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)