cas: 315718-05-9 — see every product listed under this CAS number, including other names
Benzyl 3-(hydroxymethyl)pyrrolidine-1-carboxylate, 98%, 98% (CAS 315718-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118IZ8-250mg |
| cas | 315718-05-9 |
| size | 250mg |
| availability | 34g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 315718-05-9) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl 3-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: ZRMWRJLLAVAFQP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl 3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | ZRMWRJLLAVAFQP-UHFFFAOYSA-N |
| SMILES | C1CN(CC1CO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)