cas: 185057-50-5 — see every product listed under this CAS number, including other names
Benzyl 3-Aminopyrrolidine-1-Carboxylate, 97%, 97% (CAS 185057-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118RQZ-100mg |
| cas | 185057-50-5 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 390.80 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 100g | 2267.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-aminopyrrolidine-1-carboxylate (CAS 185057-50-5) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: benzyl 3-aminopyrrolidine-1-carboxylate. InChIKey: FPXJNSKAXZNWMQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | benzyl 3-aminopyrrolidine-1-carboxylate |
| InChIKey | FPXJNSKAXZNWMQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)