cas: 185057-50-5 — see every product listed under this CAS number, including other names
Benzyl 3-aminopyrrolidine-1-carboxylate 97% (CAS 185057-50-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134390-1g |
| cas | 185057-50-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 998.94 Pln | |
| Ambeed | 100g | 2756.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A134390 |
Benzyl 3-aminopyrrolidine-1-carboxylate (CAS 185057-50-5) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: benzyl 3-aminopyrrolidine-1-carboxylate. InChIKey: FPXJNSKAXZNWMQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | benzyl 3-aminopyrrolidine-1-carboxylate |
| InChIKey | FPXJNSKAXZNWMQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)